(R)-Thalidomide
Catalog No: FT-0600001
CAS No: 2614-06-4
- Chemical Name: (R)-Thalidomide
- Molecular Formula: C13H10N2O4
- Molecular Weight: 258.23 g/mol
- InChI Key: UEJJHQNACJXSKW-SECBINFHSA-N
- InChI: InChI=1S/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17)/t9-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 2614-06-4 |
| Flash_Point: | 262.1ºC |
| Product_Name: | (R)-thalidomide |
| Bolling_Point: | 509.7ºC at 760 mmHg |
| FW: | 258.22900 |
| Melting_Point: | 269-271ºC |
| MF: | C13H10N2O4 |
| Density: | 1.503g/cm3 |
| Refractive_Index: | 1.646 |
|---|---|
| Vapor_Pressure: | 1.65E-10mmHg at 25°C |
| Flash_Point: | 262.1ºC |
| LogP: | 0.35450 |
| Bolling_Point: | 509.7ºC at 760 mmHg |
| FW: | 258.22900 |
| PSA: | 83.55000 |
| Computational_Chemistry: | ['1. XlogP 03 ', '2. Hydrogen Bond Donor Count 1 ', '3. Hydrogen Bond Acceptor Count 4 ', '4. Rotatable Bond Count 1 ', '5. Isotope Atom Count 8 ', '6. TPSA 836 ', '7. Heavy Atom Count 19 ', '8. Topological Polar Surface Area 0 ', '9. Complexity 449 ', '10. Isotope Atom Count 0 ', '11. Defined Atom Stereocenter Count 1 ', '12. Undefined Atom Stereocenter Count 0 ', '13. Defined Bond Stereocenter Count 0 ', '14. Undefined Bond Stereocenter Count 0 ', '15. Covalently-Bonded Unit Count 1'] |
| Melting_Point: | 269-271ºC |
| MF: | C13H10N2O4 |
| Exact_Mass: | 258.06400 |
| Molecular_Structure: | ['1. Molar refractive index 6235 ', '2. Molar volume 1717 ', '3. Parachor (902K)4965 ', '4. Surface tension 699 ', '5. Dielectric constant N/A ', '6. Polarizability 2471 ', '7. Single isotope mass 258064057 Da ', '8. Nominal mass 258 Da ', '9. Average mass 2582295 Da'] |
| Density: | 1.503g/cm3 |
| Symbol: | GHS07, GHS08 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2925190090 |
| Risk_Statements(EU): | R61 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | TI4925000 |
| Hazard_Codes: | T: Toxic; |
| Warning_Statement: | P201-P308 + P313 |
| Safety_Statements: | H302-H360 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)